cas: 1425970-61-1 — see every product listed under this CAS number, including other names
4-(4,4,5,5-TETRAMETHYL-[1,3,2]DIOXABOROLAN-2-YLMETHYLENE)-PIPERIDINE-1-CARBOXYLIC ACID TERT-BUTYL ESTER, 95% (CAS 1425970-61-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F505618-250MG |
| cas | 1425970-61-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 221.81 Pln | |
| Fluorochem | 5g | 534.20 Pln | |
| Fluorochem | 25g | 1565.09 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]piperidine-1-carboxylate (CAS 1425970-61-1) is a chemical compound with the molecular formula C17H30BNO4 and a molecular weight of 323.2 g/mol. IUPAC name: tert-butyl 4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]piperidine-1-carboxylate. InChIKey: RJANMUJZJKCWID-UHFFFAOYSA-N.
| Molecular formula | C17H30BNO4 |
|---|---|
| Molecular weight | 323.2 g/mol |
| IUPAC name | tert-butyl 4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]piperidine-1-carboxylate |
| InChIKey | RJANMUJZJKCWID-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C=C2CCN(CC2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)