cas: 1425970-61-1 — see every product listed under this CAS number, including other names
tert-Butyl 4-((4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylene)piperidine-1-carboxylate, 98%, 98% (CAS 1425970-61-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1140TF-100mg |
| cas | 1425970-61-1 |
| size | 100mg |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 338.00 Pln | |
| Chemat | 10g | 510.80 Pln | |
| Chemat | 25g | 957.20 Pln | |
| Chemat | 50g | 1782.80 Pln | |
| Chemat | 100g | 3165.20 Pln | |
| Chemat | 250g | 6952.40 Pln | |
| Chemat | 500g | 12307.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]piperidine-1-carboxylate (CAS 1425970-61-1) is a chemical compound with the molecular formula C17H30BNO4 and a molecular weight of 323.2 g/mol. IUPAC name: tert-butyl 4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]piperidine-1-carboxylate. InChIKey: RJANMUJZJKCWID-UHFFFAOYSA-N.
| Molecular formula | C17H30BNO4 |
|---|---|
| Molecular weight | 323.2 g/mol |
| IUPAC name | tert-butyl 4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]piperidine-1-carboxylate |
| InChIKey | RJANMUJZJKCWID-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C=C2CCN(CC2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)