cas: 1049730-42-8 — see every product listed under this CAS number, including other names
4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-1-(2,2,2-TRIFLUOROETHYL)-1H-PYRAZOLE, 95% (CAS 1049730-42-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F502725-250MG |
| cas | 1049730-42-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 138.51 Pln | |
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 570.65 Pln | |
| Fluorochem | 10g | 1044.44 Pln | |
| Fluorochem | 100g | 8536.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(2,2,2-trifluoroethyl)pyrazole (CAS 1049730-42-8) is a chemical compound with the molecular formula C11H16BF3N2O2 and a molecular weight of 276.07 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(2,2,2-trifluoroethyl)pyrazole. InChIKey: VWPXSWMYEMPJGB-UHFFFAOYSA-N.
| Molecular formula | C11H16BF3N2O2 |
|---|---|
| Molecular weight | 276.07 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(2,2,2-trifluoroethyl)pyrazole |
| InChIKey | VWPXSWMYEMPJGB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)CC(F)(F)F |
Computed by PubChem (NCBI)