cas: 1049730-42-8 — see every product listed under this CAS number, including other names
4-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)-1-(2,2,2-trifluoroethyl)-1H-pyrazole, 97%, 97% (CAS 1049730-42-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 25g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1106EJ-100mg |
| cas | 1049730-42-8 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 500mg | 155.60 Pln | |
| Chemat | 1g | 194.00 Pln | |
| Chemat | 5g | 462.80 Pln | |
| Chemat | 25g | 1878.80 Pln | |
| Chemat | 10g | 866.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(2,2,2-trifluoroethyl)pyrazole (CAS 1049730-42-8) is a chemical compound with the molecular formula C11H16BF3N2O2 and a molecular weight of 276.07 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(2,2,2-trifluoroethyl)pyrazole. InChIKey: VWPXSWMYEMPJGB-UHFFFAOYSA-N.
| Molecular formula | C11H16BF3N2O2 |
|---|---|
| Molecular weight | 276.07 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(2,2,2-trifluoroethyl)pyrazole |
| InChIKey | VWPXSWMYEMPJGB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)CC(F)(F)F |
Computed by PubChem (NCBI)