cas: 1073353-77-1 — see every product listed under this CAS number, including other names
4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1-naphthoic acid 97% (CAS 1073353-77-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A722167-100mg |
| cas | 1073353-77-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 459.38 Pln | |
| Ambeed | 1g | 1010.06 Pln | |
| Ambeed | 5g | 3396.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A722167 |
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1-carboxylic acid (CAS 1073353-77-1) is a chemical compound with the molecular formula C17H19BO4 and a molecular weight of 298.1 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1-carboxylic acid. InChIKey: NMXHQGWOOPQLBS-UHFFFAOYSA-N.
| Molecular formula | C17H19BO4 |
|---|---|
| Molecular weight | 298.1 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1-carboxylic acid |
| InChIKey | NMXHQGWOOPQLBS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C3=CC=CC=C23)C(=O)O |
Computed by PubChem (NCBI)