CAS 1073353-77-1 appears in our catalog under these names: 4-Carboxynaphthalene-1-boronic acid, pinacol ester, 97%, 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1-naphthoic acid 97%, 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1-naphthoic acid, 95%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 10g, 5g, 1g, 100mg, 250mg.
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1-carboxylic acid (CAS 1073353-77-1) is a chemical compound with the molecular formula C17H19BO4 and a molecular weight of 298.1 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1-carboxylic acid. InChIKey: NMXHQGWOOPQLBS-UHFFFAOYSA-N.
| Molecular formula | C17H19BO4 |
|---|---|
| Molecular weight | 298.1 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1-carboxylic acid |
| InChIKey | NMXHQGWOOPQLBS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C3=CC=CC=C23)C(=O)O |
Computed by PubChem (NCBI)