cas: 1000802-50-5 — see every product listed under this CAS number, including other names
4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole-1-propanol, 97%, 97% (CAS 1000802-50-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1111VA-100mg |
| cas | 1000802-50-5 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 275.60 Pln | |
| Chemat | 250mg | 386.00 Pln | |
| Chemat | 500mg | 554.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propan-1-ol (CAS 1000802-50-5) is a chemical compound with the molecular formula C12H21BN2O3 and a molecular weight of 252.12 g/mol. IUPAC name: 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propan-1-ol. InChIKey: ZVUJZEKDRFLYFL-UHFFFAOYSA-N.
| Molecular formula | C12H21BN2O3 |
|---|---|
| Molecular weight | 252.12 g/mol |
| IUPAC name | 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propan-1-ol |
| InChIKey | ZVUJZEKDRFLYFL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)CCCO |
Computed by PubChem (NCBI)