cas: 2096994-97-5 — see every product listed under this CAS number, including other names
4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinecarboxamide 95% (CAS 2096994-97-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A965494-100mg |
| cas | 2096994-97-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 693.00 Pln | |
| Ambeed | 250mg | 1149.12 Pln | |
| Ambeed | 1g | 2895.75 Pln | |
| Ambeed | 5g | 8363.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A965494 |
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxamide (CAS 2096994-97-5) is a chemical compound with the molecular formula C12H17BN2O3 and a molecular weight of 248.09 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxamide. InChIKey: CSHBTZCOWNUVPN-UHFFFAOYSA-N.
| Molecular formula | C12H17BN2O3 |
|---|---|
| Molecular weight | 248.09 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxamide |
| InChIKey | CSHBTZCOWNUVPN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=C2)C(=O)N |
Computed by PubChem (NCBI)