CAS 1384954-82-8 appears in our catalog under these names: 4-(4-Acetyl-1-piperazinyl)phenylboronic acid, 96%, 4–(4–Acetyl–1–piperazinyl)phenylboronic Acid, (4-(4-Acetylpiperazin-1-yl)phenyl)boronic acid, >95%, >95%, 4-(4-ACETYL-1-PIPERAZINYL)PHENYLBORONIC ACID. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
[4-(4-acetylpiperazin-1-yl)phenyl]boronic acid (CAS 1384954-82-8) is a chemical compound with the molecular formula C12H17BN2O3 and a molecular weight of 248.09 g/mol. IUPAC name: [4-(4-acetylpiperazin-1-yl)phenyl]boronic acid. InChIKey: NEPZCNSUXGOPPC-UHFFFAOYSA-N.
| Molecular formula | C12H17BN2O3 |
|---|---|
| Molecular weight | 248.09 g/mol |
| IUPAC name | [4-(4-acetylpiperazin-1-yl)phenyl]boronic acid |
| InChIKey | NEPZCNSUXGOPPC-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)N2CCN(CC2)C(=O)C)(O)O |
Computed by PubChem (NCBI)