cas: 1255309-13-7 — see every product listed under this CAS number, including other names
4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-carbazole, 97% (CAS 1255309-13-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F605593-100MG |
| cas | 1255309-13-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 102.07 Pln | |
| Fluorochem | 250mg | 122.89 Pln | |
| Fluorochem | 1g | 169.75 Pln | |
| Fluorochem | 5g | 529.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-carbazole (CAS 1255309-13-7) is a chemical compound with the molecular formula C18H20BNO2 and a molecular weight of 293.2 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-carbazole. InChIKey: BLFDNIPIBSFUEL-UHFFFAOYSA-N.
| Molecular formula | C18H20BNO2 |
|---|---|
| Molecular weight | 293.2 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-carbazole |
| InChIKey | BLFDNIPIBSFUEL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C4=CC=CC=C4NC3=CC=C2 |
Computed by PubChem (NCBI)