cas: 1255309-13-7 — see every product listed under this CAS number, including other names
4-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)-9H-carbazole, 97%, 97% (CAS 1255309-13-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HI0V-100mg |
| cas | 1255309-13-7 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 410.00 Pln | |
| Chemat | 25g | 1336.40 Pln | |
| Chemat | 10g | 650.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-carbazole (CAS 1255309-13-7) is a chemical compound with the molecular formula C18H20BNO2 and a molecular weight of 293.2 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-carbazole. InChIKey: BLFDNIPIBSFUEL-UHFFFAOYSA-N.
| Molecular formula | C18H20BNO2 |
|---|---|
| Molecular weight | 293.2 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-carbazole |
| InChIKey | BLFDNIPIBSFUEL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C4=CC=CC=C4NC3=CC=C2 |
Computed by PubChem (NCBI)