cas: 1251459-71-8 — see every product listed under this CAS number, including other names
4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)isothiazole 97% (CAS 1251459-71-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A440449-100mg |
| cas | 1251459-71-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 637.38 Pln | |
| Ambeed | 250mg | 987.81 Pln | |
| Ambeed | 1g | 1927.88 Pln | |
| Ambeed | 5g | 7612.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A440449 |
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-thiazole (CAS 1251459-71-8) is a chemical compound with the molecular formula C9H14BNO2S and a molecular weight of 211.09 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-thiazole. InChIKey: IBFHUXAMFFTLKO-UHFFFAOYSA-N.
| Molecular formula | C9H14BNO2S |
|---|---|
| Molecular weight | 211.09 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-thiazole |
| InChIKey | IBFHUXAMFFTLKO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CSN=C2 |
Computed by PubChem (NCBI)