Products 1218790-69-2

CAS 1218790-69-2 is the registry number for 2-(Isobutylthio)pyridine-5-boronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

[6-(2-methylpropylsulfanyl)-3-pyridinyl]boronic acid (CAS 1218790-69-2) is a chemical compound with the molecular formula C9H14BNO2S and a molecular weight of 211.09 g/mol. IUPAC name: [6-(2-methylpropylsulfanyl)-3-pyridinyl]boronic acid. InChIKey: RYVQQLHCZKHBIX-UHFFFAOYSA-N.

Identity
Molecular formulaC9H14BNO2S
Molecular weight211.09 g/mol
IUPAC name[6-(2-methylpropylsulfanyl)-3-pyridinyl]boronic acid
InChIKeyRYVQQLHCZKHBIX-UHFFFAOYSA-N
SMILESB(C1=CN=C(C=C1)SCC(C)C)(O)O

Computed by PubChem (NCBI)