cas: 913836-28-9 — see every product listed under this CAS number, including other names
4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl piperidine-1-carboxylate, 96% (CAS 913836-28-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F218450-1G |
| cas | 913836-28-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1205.84 Pln | |
| Fluorochem | 5g | 4595.27 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] piperidine-1-carboxylate (CAS 913836-28-9) is a chemical compound with the molecular formula C18H26BNO4 and a molecular weight of 331.2 g/mol. IUPAC name: [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] piperidine-1-carboxylate. InChIKey: KDAWCRTUINGBQJ-UHFFFAOYSA-N.
| Molecular formula | C18H26BNO4 |
|---|---|
| Molecular weight | 331.2 g/mol |
| IUPAC name | [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] piperidine-1-carboxylate |
| InChIKey | KDAWCRTUINGBQJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OC(=O)N3CCCCC3 |
Computed by PubChem (NCBI)