CAS 1073355-06-2 is the registry number for 3-(Tetrahydrofurfurylaminocarbonyl)phenylboronic acid pinacol ester, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-(oxolan-2-ylmethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 1073355-06-2) is a chemical compound with the molecular formula C18H26BNO4 and a molecular weight of 331.2 g/mol. IUPAC name: N-(oxolan-2-ylmethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: KHXJYLFLGVPADA-UHFFFAOYSA-N.
| Molecular formula | C18H26BNO4 |
|---|---|
| Molecular weight | 331.2 g/mol |
| IUPAC name | N-(oxolan-2-ylmethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | KHXJYLFLGVPADA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C(=O)NCC3CCCO3 |
Computed by PubChem (NCBI)