cas: 1626413-51-1 — see every product listed under this CAS number, including other names
4-(4-(3-Nitrophenyl)-1H-1,2,3-triazol-1-yl)butan-1-amine, 98% (CAS 1626413-51-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A735883-100mg |
| cas | 1626413-51-1 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 2120.65 Pln | |
| AmBeed | 1g | 7882.00 Pln | |
| AmBeed | 5g | 20446.30 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-[4-(3-nitrophenyl)triazol-1-yl]butan-1-amine (CAS 1626413-51-1) is a chemical compound with the molecular formula C12H15N5O2 and a molecular weight of 261.28 g/mol. IUPAC name: 4-[4-(3-nitrophenyl)triazol-1-yl]butan-1-amine. InChIKey: VUZNHJRCHGAGEQ-UHFFFAOYSA-N.
| Molecular formula | C12H15N5O2 |
|---|---|
| Molecular weight | 261.28 g/mol |
| IUPAC name | 4-[4-(3-nitrophenyl)triazol-1-yl]butan-1-amine |
| InChIKey | VUZNHJRCHGAGEQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=CN(N=N2)CCCCN |
Computed by PubChem (NCBI)