CAS 91644-39-2 is the registry number for Ethyl 5-amino-1-(4,6-dimethylpyrimidin-2-yl)-1h-pyrazole-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl 5-amino-1-(4,6-dimethylpyrimidin-2-yl)pyrazole-4-carboxylate (CAS 91644-39-2) is a chemical compound with the molecular formula C12H15N5O2 and a molecular weight of 261.28 g/mol. IUPAC name: ethyl 5-amino-1-(4,6-dimethylpyrimidin-2-yl)pyrazole-4-carboxylate. InChIKey: CXLVWGJEYPJEAG-UHFFFAOYSA-N.
| Molecular formula | C12H15N5O2 |
|---|---|
| Molecular weight | 261.28 g/mol |
| IUPAC name | ethyl 5-amino-1-(4,6-dimethylpyrimidin-2-yl)pyrazole-4-carboxylate |
| InChIKey | CXLVWGJEYPJEAG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=C1)C2=NC(=CC(=N2)C)C)N |
Computed by PubChem (NCBI)