cas: 944591-57-5 — see every product listed under this CAS number, including other names
4-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)morpholine hydrochloride 97% (CAS 944591-57-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A717159-1g |
| cas | 944591-57-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 464.94 Pln | |
| Ambeed | 25g | 1115.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A717159 |
4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine;hydrochloride (CAS 944591-57-5) is a chemical compound with the molecular formula C17H27BClNO3 and a molecular weight of 339.7 g/mol. IUPAC name: 4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine;hydrochloride. InChIKey: XUHPRNOSIRFDFA-UHFFFAOYSA-N.
| Molecular formula | C17H27BClNO3 |
|---|---|
| Molecular weight | 339.7 g/mol |
| IUPAC name | 4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine;hydrochloride |
| InChIKey | XUHPRNOSIRFDFA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CN3CCOCC3.Cl |
Computed by PubChem (NCBI)