CAS 1073371-76-2 is the registry number for 3-(4-Morpholinomethyl)phenylboronic acid pinacol ester hydrochloride, 96%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
4-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine;hydrochloride (CAS 1073371-76-2) is a chemical compound with the molecular formula C17H27BClNO3 and a molecular weight of 339.7 g/mol. IUPAC name: 4-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine;hydrochloride. InChIKey: SESGBRITCBGLIH-UHFFFAOYSA-N.
| Molecular formula | C17H27BClNO3 |
|---|---|
| Molecular weight | 339.7 g/mol |
| IUPAC name | 4-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine;hydrochloride |
| InChIKey | SESGBRITCBGLIH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)CN3CCOCC3.Cl |
Computed by PubChem (NCBI)