cas: 756520-75-9 — see every product listed under this CAS number, including other names
4-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)-1H-pyrazole 98% (CAS 756520-75-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A688864-100mg |
| cas | 756520-75-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 620.69 Pln | |
| Ambeed | 250mg | 1010.06 Pln | |
| Ambeed | 1g | 2428.50 Pln | |
| Ambeed | 5g | 7139.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A688864 |
4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-pyrazole (CAS 756520-75-9) is a chemical compound with the molecular formula C15H19BN2O2 and a molecular weight of 270.14 g/mol. IUPAC name: 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-pyrazole. InChIKey: OWISFFAMZILFMN-UHFFFAOYSA-N.
| Molecular formula | C15H19BN2O2 |
|---|---|
| Molecular weight | 270.14 g/mol |
| IUPAC name | 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-pyrazole |
| InChIKey | OWISFFAMZILFMN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3=CNN=C3 |
Computed by PubChem (NCBI)