CAS 2221800-07-1 is the registry number for 4-(3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)-1H-pyrazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-pyrazole (CAS 2221800-07-1) is a chemical compound with the molecular formula C15H19BN2O2 and a molecular weight of 270.14 g/mol. IUPAC name: 4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-pyrazole. InChIKey: LZVAIDIQNBTCAB-UHFFFAOYSA-N.
| Molecular formula | C15H19BN2O2 |
|---|---|
| Molecular weight | 270.14 g/mol |
| IUPAC name | 4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-pyrazole |
| InChIKey | LZVAIDIQNBTCAB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C3=CNN=C3 |
Computed by PubChem (NCBI)