cas: 287952-67-4 — see every product listed under this CAS number, including other names
4-(4-(Trifluoromethoxy)phenoxy)piperidine, 98% (CAS 287952-67-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F212319-1G |
| cas | 287952-67-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 174.96 Pln | |
| Fluorochem | 10g | 263.47 Pln | |
| Fluorochem | 25g | 575.86 Pln | |
| Fluorochem | 100g | 2132.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
4-[4-(trifluoromethoxy)phenoxy]piperidine (CAS 287952-67-4) is a chemical compound with the molecular formula C12H14F3NO2 and a molecular weight of 261.24 g/mol. IUPAC name: 4-[4-(trifluoromethoxy)phenoxy]piperidine. InChIKey: RPQOTFPZKNHYFB-UHFFFAOYSA-N.
| Molecular formula | C12H14F3NO2 |
|---|---|
| Molecular weight | 261.24 g/mol |
| IUPAC name | 4-[4-(trifluoromethoxy)phenoxy]piperidine |
| InChIKey | RPQOTFPZKNHYFB-UHFFFAOYSA-N |
| SMILES | C1CNCCC1OC2=CC=C(C=C2)OC(F)(F)F |
Computed by PubChem (NCBI)