Products 681482-14-4
CAS 681482-14-4 is the registry number for (S)-2-(4-Trifluoromethoxyphenoxymethyl)-pyrrolidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2S)-2-[[4-(trifluoromethoxy)phenoxy]methyl]pyrrolidine (CAS 681482-14-4) is a chemical compound with the molecular formula C12H14F3NO2 and a molecular weight of 261.24 g/mol. IUPAC name: (2S)-2-[[4-(trifluoromethoxy)phenoxy]methyl]pyrrolidine. InChIKey: CAJKWKYHIUIQTB-VIFPVBQESA-N.
| Molecular formula | C12H14F3NO2 |
|---|---|
| Molecular weight | 261.24 g/mol |
| IUPAC name | (2S)-2-[[4-(trifluoromethoxy)phenoxy]methyl]pyrrolidine |
| InChIKey | CAJKWKYHIUIQTB-VIFPVBQESA-N |
| SMILES | C1C[C@H](NC1)COC2=CC=C(C=C2)OC(F)(F)F |
Computed by PubChem (NCBI)