cas: 287952-09-4 — see every product listed under this CAS number, including other names
4-(4-(Trifluoromethyl)phenoxy)piperidine hydrochloride, 95%, 95% (CAS 287952-09-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113WIL-250mg |
| cas | 287952-09-4 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 357.20 Pln | |
| Chemat | 5g | 1221.20 Pln | |
| Chemat | 10g | 1994.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-[4-(trifluoromethyl)phenoxy]piperidine;hydrochloride (CAS 287952-09-4) is a chemical compound with the molecular formula C12H15ClF3NO and a molecular weight of 281.70 g/mol. IUPAC name: 4-[4-(trifluoromethyl)phenoxy]piperidine;hydrochloride. InChIKey: QCMLOHSHCOOPQB-UHFFFAOYSA-N.
| Molecular formula | C12H15ClF3NO |
|---|---|
| Molecular weight | 281.70 g/mol |
| IUPAC name | 4-[4-(trifluoromethyl)phenoxy]piperidine;hydrochloride |
| InChIKey | QCMLOHSHCOOPQB-UHFFFAOYSA-N |
| SMILES | C1CNCCC1OC2=CC=C(C=C2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)