CAS 1004618-85-2 appears in our catalog under these names: 4-(4-(Trifluoromethoxy)phenyl)piperidine hydrochloride, 95%, 4-(4-(Trifluoromethoxy)phenyl)piperidine hydrochloride, 4-(4-(Trifluoromethoxy)phenyl)piperidine hydrochloride 97%, 4-(4-(Trifluoromethoxy)phenyl)piperidine hydrochloride, 98%, 98%, 4-(4-(Trifluoromethoxy)phenyl)piperidine hydrochloride, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 0,5g, 50mg, 25g, 2.5g.
4-[4-(trifluoromethoxy)phenyl]piperidine;hydrochloride (CAS 1004618-85-2) is a chemical compound with the molecular formula C12H15ClF3NO and a molecular weight of 281.70 g/mol. IUPAC name: 4-[4-(trifluoromethoxy)phenyl]piperidine;hydrochloride. InChIKey: XLVUSJGPLOCSCC-UHFFFAOYSA-N.
| Molecular formula | C12H15ClF3NO |
|---|---|
| Molecular weight | 281.70 g/mol |
| IUPAC name | 4-[4-(trifluoromethoxy)phenyl]piperidine;hydrochloride |
| InChIKey | XLVUSJGPLOCSCC-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C2=CC=C(C=C2)OC(F)(F)F.Cl |
Computed by PubChem (NCBI)