cas: 1384954-82-8 — see every product listed under this CAS number, including other names
4-(4-ACETYL-1-PIPERAZINYL)PHENYLBORONIC ACID (CAS 1384954-82-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F387188-250MG |
| cas | 1384954-82-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1034.03 Pln | |
| Fluorochem | 1g | 1153.78 Pln | |
| Fluorochem | 5g | 5454.35 Pln |
| delivery time | 3-4 weeks |
|---|
[4-(4-acetylpiperazin-1-yl)phenyl]boronic acid (CAS 1384954-82-8) is a chemical compound with the molecular formula C12H17BN2O3 and a molecular weight of 248.09 g/mol. IUPAC name: [4-(4-acetylpiperazin-1-yl)phenyl]boronic acid. InChIKey: NEPZCNSUXGOPPC-UHFFFAOYSA-N.
| Molecular formula | C12H17BN2O3 |
|---|---|
| Molecular weight | 248.09 g/mol |
| IUPAC name | [4-(4-acetylpiperazin-1-yl)phenyl]boronic acid |
| InChIKey | NEPZCNSUXGOPPC-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)N2CCN(CC2)C(=O)C)(O)O |
Computed by PubChem (NCBI)