cas: 31465-35-7 — see every product listed under this CAS number, including other names
4-(4-Bromophenoxy)aniline 98% (CAS 31465-35-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A449196-5g |
| cas | 31465-35-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 520.56 Pln | |
| Ambeed | 10g | 748.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A449196 |
4-(4-bromophenoxy)aniline (CAS 31465-35-7) is a chemical compound with the molecular formula C12H10BrNO and a molecular weight of 264.12 g/mol. IUPAC name: 4-(4-bromophenoxy)aniline. InChIKey: ZQMNUMBREHBKEB-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO |
|---|---|
| Molecular weight | 264.12 g/mol |
| IUPAC name | 4-(4-bromophenoxy)aniline |
| InChIKey | ZQMNUMBREHBKEB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)OC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)