CAS 885524-89-0 is the registry number for 4-(4-Bromophenoxymethyl)aniline. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
4-[(4-bromophenoxy)methyl]aniline (CAS 885524-89-0) is a chemical compound with the molecular formula C13H12BrNO and a molecular weight of 278.14 g/mol. IUPAC name: 4-[(4-bromophenoxy)methyl]aniline. InChIKey: NFOYHNFVIWDOSU-UHFFFAOYSA-N.
| Molecular formula | C13H12BrNO |
|---|---|
| Molecular weight | 278.14 g/mol |
| IUPAC name | 4-[(4-bromophenoxy)methyl]aniline |
| InChIKey | NFOYHNFVIWDOSU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1COC2=CC=C(C=C2)Br)N |
Computed by PubChem (NCBI)