CAS 885681-79-8 is the registry number for 3-Bromo-5-(4-methoxyphenyl)-4-methylpyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
3-bromo-5-(4-methoxyphenyl)-4-methylpyridine (CAS 885681-79-8) is a chemical compound with the molecular formula C13H12BrNO and a molecular weight of 278.14 g/mol. IUPAC name: 3-bromo-5-(4-methoxyphenyl)-4-methylpyridine. InChIKey: FVAFAAKOWUXSNM-UHFFFAOYSA-N.
| Molecular formula | C13H12BrNO |
|---|---|
| Molecular weight | 278.14 g/mol |
| IUPAC name | 3-bromo-5-(4-methoxyphenyl)-4-methylpyridine |
| InChIKey | FVAFAAKOWUXSNM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NC=C1C2=CC=C(C=C2)OC)Br |
Computed by PubChem (NCBI)