cas: 333987-04-5 — see every product listed under this CAS number, including other names
4-(4-Cyanobenzyl)piperidine, HCl 97% (CAS 333987-04-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A110962-100mg |
| cas | 333987-04-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 414.88 Pln | |
| Ambeed | 250mg | 693.00 Pln | |
| Ambeed | 1g | 1672.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A110962 |
4-(piperidin-4-ylmethyl)benzonitrile;hydrochloride (CAS 333987-04-5) is a chemical compound with the molecular formula C13H17ClN2 and a molecular weight of 236.74 g/mol. IUPAC name: 4-(piperidin-4-ylmethyl)benzonitrile;hydrochloride. InChIKey: FRVVADSLOPUQJI-UHFFFAOYSA-N.
| Molecular formula | C13H17ClN2 |
|---|---|
| Molecular weight | 236.74 g/mol |
| IUPAC name | 4-(piperidin-4-ylmethyl)benzonitrile;hydrochloride |
| InChIKey | FRVVADSLOPUQJI-UHFFFAOYSA-N |
| SMILES | C1CNCCC1CC2=CC=C(C=C2)C#N.Cl |
Computed by PubChem (NCBI)