CAS 1820717-84-7 is the registry number for 2-Chloro-5-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)-3-methylpyridine, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-chloro-5-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)-3-methylpyridine (CAS 1820717-84-7) is a chemical compound with the molecular formula C13H17ClN2 and a molecular weight of 236.74 g/mol. IUPAC name: 2-chloro-5-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)-3-methylpyridine. InChIKey: VHHSFXGQAFPKFV-UHFFFAOYSA-N.
| Molecular formula | C13H17ClN2 |
|---|---|
| Molecular weight | 236.74 g/mol |
| IUPAC name | 2-chloro-5-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)-3-methylpyridine |
| InChIKey | VHHSFXGQAFPKFV-UHFFFAOYSA-N |
| SMILES | CCN1CCC(=CC1)C2=CN=C(C(=C2)C)Cl |
Computed by PubChem (NCBI)