cas: 192329-91-2 — see every product listed under this CAS number, including other names
4-(4-Fluorophenoxy)benzenesulfonyl chloride (CAS 192329-91-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 2.5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F014907-250MG |
| cas | 192329-91-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 987.17 Pln | |
| Fluorochem | 500mg | 1341.21 Pln | |
| Fluorochem | 1g | 2127.39 Pln | |
| Fluorochem | 2.5g | 4199.58 Pln |
| delivery time | 2-3 weeks |
|---|
4-(4-fluorophenoxy)benzenesulfonyl chloride (CAS 192329-91-2) is a chemical compound with the molecular formula C12H8ClFO3S and a molecular weight of 286.71 g/mol. IUPAC name: 4-(4-fluorophenoxy)benzenesulfonyl chloride. InChIKey: PDAYRCHIAPCRRD-UHFFFAOYSA-N.
| Molecular formula | C12H8ClFO3S |
|---|---|
| Molecular weight | 286.71 g/mol |
| IUPAC name | 4-(4-fluorophenoxy)benzenesulfonyl chloride |
| InChIKey | PDAYRCHIAPCRRD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=CC=C(C=C2)S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)