Products 885950-85-6

CAS 885950-85-6 appears in our catalog under these names: [3-(4-Fluorophenoxy)phenyl]sulfonyl chloride, 95%, 3-(4-Fluorophenoxy)benzene-1-sulfonyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.

Structural formula: {0} (CAS {1})

3-(4-fluorophenoxy)benzenesulfonyl chloride (CAS 885950-85-6) is a chemical compound with the molecular formula C12H8ClFO3S and a molecular weight of 286.71 g/mol. IUPAC name: 3-(4-fluorophenoxy)benzenesulfonyl chloride. InChIKey: FATHTQRFJMILKX-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8ClFO3S
Molecular weight286.71 g/mol
IUPAC name3-(4-fluorophenoxy)benzenesulfonyl chloride
InChIKeyFATHTQRFJMILKX-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)S(=O)(=O)Cl)OC2=CC=C(C=C2)F

Computed by PubChem (NCBI)