cas: 3202-34-4 — see every product listed under this CAS number, including other names
4-(4-Fluorophenoxy)piperidine hydrochloride (CAS 3202-34-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F240851-250MG |
| cas | 3202-34-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 674.78 Pln | |
| Fluorochem | 500mg | 810.15 Pln | |
| Fluorochem | 1g | 1174.60 Pln | |
| Fluorochem | 5g | 3376.95 Pln |
| delivery time | 2-3 weeks |
|---|
4-(4-fluorophenoxy)piperidine;hydrochloride (CAS 3202-34-4) is a chemical compound with the molecular formula C11H15ClFNO and a molecular weight of 231.69 g/mol. IUPAC name: 4-(4-fluorophenoxy)piperidine;hydrochloride. InChIKey: NIIGVDMAHQTQSA-UHFFFAOYSA-N.
| Molecular formula | C11H15ClFNO |
|---|---|
| Molecular weight | 231.69 g/mol |
| IUPAC name | 4-(4-fluorophenoxy)piperidine;hydrochloride |
| InChIKey | NIIGVDMAHQTQSA-UHFFFAOYSA-N |
| SMILES | C1CNCCC1OC2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)