cas: 264122-82-9 — see every product listed under this CAS number, including other names
4-(4-Fluorophenyl)pyrrolidin-2-one, 97%, 97% (CAS 264122-82-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113T45-100mg |
| cas | 264122-82-9 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 242.00 Pln | |
| Chemat | 1g | 784.40 Pln | |
| Chemat | 5g | 2848.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-(4-fluorophenyl)pyrrolidin-2-one (CAS 264122-82-9) is a chemical compound with the molecular formula C10H10FNO and a molecular weight of 179.19 g/mol. IUPAC name: 4-(4-fluorophenyl)pyrrolidin-2-one. InChIKey: JIQYWLZCHCBUSG-UHFFFAOYSA-N.
| Molecular formula | C10H10FNO |
|---|---|
| Molecular weight | 179.19 g/mol |
| IUPAC name | 4-(4-fluorophenyl)pyrrolidin-2-one |
| InChIKey | JIQYWLZCHCBUSG-UHFFFAOYSA-N |
| SMILES | C1C(CNC1=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)