cas: 1073354-18-3 — see every product listed under this CAS number, including other names
4-(4-Isopropylpiperizinyl)phenylboronic acid, pinacol ester, 98%, 98% (CAS 1073354-18-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118ENJ-100mg |
| cas | 1073354-18-3 |
| size | 100mg |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 256.40 Pln | |
| Chemat | 1g | 606.80 Pln | |
| Chemat | 5g | 2565.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-propan-2-yl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine (CAS 1073354-18-3) is a chemical compound with the molecular formula C19H31BN2O2 and a molecular weight of 330.3 g/mol. IUPAC name: 1-propan-2-yl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine. InChIKey: CSORKGLMGUQQOY-UHFFFAOYSA-N.
| Molecular formula | C19H31BN2O2 |
|---|---|
| Molecular weight | 330.3 g/mol |
| IUPAC name | 1-propan-2-yl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine |
| InChIKey | CSORKGLMGUQQOY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)N3CCN(CC3)C(C)C |
Computed by PubChem (NCBI)