cas: 1083-48-3 — see every product listed under this CAS number, including other names
4-(4-Nitrobenzyl)pyridine, 98%(GC-MS),RG, 98%(GC-MS),RG (CAS 1083-48-3) is a chemical reagent available from Chemat. Available pack sizes: 25g, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114K5O-25g |
| cas | 1083-48-3 |
| size | 25g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 770.00 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 261.20 Pln |
| purity | 98%(GC-MS),RG |
|---|---|
| delivery time | 3 weeks |
4-[(4-nitrophenyl)methyl]pyridine (CAS 1083-48-3) is a chemical compound with the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. IUPAC name: 4-[(4-nitrophenyl)methyl]pyridine. InChIKey: MNHKUCBXXMFQDM-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O2 |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | 4-[(4-nitrophenyl)methyl]pyridine |
| InChIKey | MNHKUCBXXMFQDM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=CC=NC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)