CAS 579476-25-8 is the registry number for Methyl 3-(pyrimidin-2-yl)benzoate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 3-pyrimidin-2-ylbenzoate (CAS 579476-25-8) is a chemical compound with the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. IUPAC name: methyl 3-pyrimidin-2-ylbenzoate. InChIKey: IOJFNHUNCBUINL-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O2 |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | methyl 3-pyrimidin-2-ylbenzoate |
| InChIKey | IOJFNHUNCBUINL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC(=C1)C2=NC=CC=N2 |
Computed by PubChem (NCBI)