cas: 220298-96-4 — see every product listed under this CAS number, including other names
4-(Aminomethyl)-1-N-Boc-aniline, 95% (CAS 220298-96-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F011386-100MG |
| cas | 220298-96-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 102.07 Pln | |
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 1g | 200.99 Pln | |
| Fluorochem | 5g | 695.61 Pln | |
| Fluorochem | 10g | 1299.56 Pln | |
| Fluorochem | 25g | 2955.23 Pln | |
| Fluorochem | 100g | 10062.10 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[4-(aminomethyl)phenyl]carbamate (CAS 220298-96-4) is a chemical compound with the molecular formula C12H18N2O2 and a molecular weight of 222.28 g/mol. IUPAC name: tert-butyl N-[4-(aminomethyl)phenyl]carbamate. InChIKey: URXUHALBOWYXJZ-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O2 |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | tert-butyl N-[4-(aminomethyl)phenyl]carbamate |
| InChIKey | URXUHALBOWYXJZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=C(C=C1)CN |
Computed by PubChem (NCBI)