CAS 660838-05-1 appears in our catalog under these names: (3-Amino-4-methyl-phenyl)-carbamic acid tert-butyl ester, 98%, N1–Boc–4–methyl–1,3–phenylenediamine, N1-Boc-4-methyl-1,3-phenylenediamine 97%, N1-Boc-4-methyl-1,3-phenylenediamine, 97%, 97%, 5-(BOC-AMINO)-2-METHYLANILINE, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 10g, 250mg.
Tert-butyl N-(3-amino-4-methylphenyl)carbamate (CAS 660838-05-1) is a chemical compound with the molecular formula C12H18N2O2 and a molecular weight of 222.28 g/mol. IUPAC name: tert-butyl N-(3-amino-4-methylphenyl)carbamate. InChIKey: HOVDUPXBRBXFBP-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O2 |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | tert-butyl N-(3-amino-4-methylphenyl)carbamate |
| InChIKey | HOVDUPXBRBXFBP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)