cas: 1141894-75-8 — see every product listed under this CAS number, including other names
4-(Aminomethyl)-3-(trifluoromethyl)benzonitrile 95% (CAS 1141894-75-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A186972-100mg |
| cas | 1141894-75-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 837.62 Pln | |
| Ambeed | 250mg | 1371.62 Pln | |
| Ambeed | 1g | 3018.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A186972 |
4-(aminomethyl)-3-(trifluoromethyl)benzonitrile (CAS 1141894-75-8) is a chemical compound with the molecular formula C9H7F3N2 and a molecular weight of 200.16 g/mol. IUPAC name: 4-(aminomethyl)-3-(trifluoromethyl)benzonitrile. InChIKey: QUZPTSQKVWERRT-UHFFFAOYSA-N.
| Molecular formula | C9H7F3N2 |
|---|---|
| Molecular weight | 200.16 g/mol |
| IUPAC name | 4-(aminomethyl)-3-(trifluoromethyl)benzonitrile |
| InChIKey | QUZPTSQKVWERRT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#N)C(F)(F)F)CN |
Computed by PubChem (NCBI)