cas: 1629037-78-0 — see every product listed under this CAS number, including other names
4-(Benzyloxy)-1H-pyrazolo[4,3-c]pyridin-3-amine 98% (CAS 1629037-78-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A361176-50mg |
| cas | 1629037-78-0 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 832.06 Pln | |
| Ambeed | 100mg | 1293.75 Pln | |
| Ambeed | 250mg | 2039.12 Pln | |
| Ambeed | 1g | 5237.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A361176 |
4-phenylmethoxy-1H-pyrazolo[4,3-c]pyridin-3-amine (CAS 1629037-78-0) is a chemical compound with the molecular formula C13H12N4O and a molecular weight of 240.26 g/mol. IUPAC name: 4-phenylmethoxy-1H-pyrazolo[4,3-c]pyridin-3-amine. InChIKey: XAOCPULRMFPHEN-UHFFFAOYSA-N.
| Molecular formula | C13H12N4O |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | 4-phenylmethoxy-1H-pyrazolo[4,3-c]pyridin-3-amine |
| InChIKey | XAOCPULRMFPHEN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=NC=CC3=C2C(=NN3)N |
Computed by PubChem (NCBI)