CAS 879069-03-1 is the registry number for 5-Imidazo[1,2-a]pyrimidin-2-yl-2-methoxyaniline, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
5-imidazo[1,2-a]pyrimidin-2-yl-2-methoxyaniline (CAS 879069-03-1) is a chemical compound with the molecular formula C13H12N4O and a molecular weight of 240.26 g/mol. IUPAC name: 5-imidazo[1,2-a]pyrimidin-2-yl-2-methoxyaniline. InChIKey: GLWICUZSVZAJCV-UHFFFAOYSA-N.
| Molecular formula | C13H12N4O |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | 5-imidazo[1,2-a]pyrimidin-2-yl-2-methoxyaniline |
| InChIKey | GLWICUZSVZAJCV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CN3C=CC=NC3=N2)N |
Computed by PubChem (NCBI)