4-(Benzyloxy)-3-bromopyridine, 98%
cas: 1019767-63-5 — see every product listed under this CAS number, including other names
4-(Benzyloxy)-3-bromopyridine, 98% (CAS 1019767-63-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A456706-100mg |
| cas | 1019767-63-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 197.94 Pln | |
| Ambeed | 250mg | 309.19 Pln | |
| Ambeed | 1g | 709.69 Pln | |
| Ambeed | 5g | 2211.56 Pln | |
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 250mg | 323.60 Pln | |
| Chemat | 1g | 741.20 Pln | |
| Chemat | 5g | 2296.40 Pln | |
| BLDpharm | 100mg | 219.95 Pln | |
| BLDpharm | 250mg | 336.57 Pln | |
| BLDpharm | 1g | 769.75 Pln | |
| BLDpharm | 5g | 2391.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
3-bromo-4-phenylmethoxypyridine (CAS 1019767-63-5) is a chemical compound with the molecular formula C12H10BrNO and a molecular weight of 264.12 g/mol. IUPAC name: 3-bromo-4-phenylmethoxypyridine. InChIKey: WYXHPRLZHHYGQN-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO |
|---|---|
| Molecular weight | 264.12 g/mol |
| IUPAC name | 3-bromo-4-phenylmethoxypyridine |
| InChIKey | WYXHPRLZHHYGQN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=NC=C2)Br |
Computed by PubChem (NCBI)