CAS 6373-46-2 appears in our catalog under these names: 4-Benzyloxyaniline, 98%, 4–(Benzyloxy)aniline, 4-(Benzyloxy)aniline, >98.0%(GC)(T), 4-BENZYLOXYANALINE, 98%, 98%, 4-(Benzyloxy)aniline, 97%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100g, 10g, 500g.
4-phenylmethoxyaniline (CAS 6373-46-2) is a chemical compound with the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. IUPAC name: 4-phenylmethoxyaniline. InChIKey: FIIDVVUUWRJXLF-UHFFFAOYSA-N.
| Molecular formula | C13H13NO |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 4-phenylmethoxyaniline |
| InChIKey | FIIDVVUUWRJXLF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)