cas: 39188-62-0 — see every product listed under this CAS number, including other names
4-(Benzyloxy)phenylacetyl Chloride 98% (CAS 39188-62-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A783792-1g |
| cas | 39188-62-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 515.00 Pln | |
| Ambeed | 25g | 1616.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A783792 |
2-(4-phenylmethoxyphenyl)acetyl chloride (CAS 39188-62-0) is a chemical compound with the molecular formula C15H13ClO2 and a molecular weight of 260.71 g/mol. IUPAC name: 2-(4-phenylmethoxyphenyl)acetyl chloride. InChIKey: GZAGJMNAVUCWGM-UHFFFAOYSA-N.
| Molecular formula | C15H13ClO2 |
|---|---|
| Molecular weight | 260.71 g/mol |
| IUPAC name | 2-(4-phenylmethoxyphenyl)acetyl chloride |
| InChIKey | GZAGJMNAVUCWGM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)CC(=O)Cl |
Computed by PubChem (NCBI)