CAS 884323-17-5 is the registry number for 2-Chloro-4-(3,5-dimethylphenyl)benzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-chloro-4-(3,5-dimethylphenyl)benzoic acid (CAS 884323-17-5) is a chemical compound with the molecular formula C15H13ClO2 and a molecular weight of 260.71 g/mol. IUPAC name: 2-chloro-4-(3,5-dimethylphenyl)benzoic acid. InChIKey: WNPIQYRMRNJDCX-UHFFFAOYSA-N.
| Molecular formula | C15H13ClO2 |
|---|---|
| Molecular weight | 260.71 g/mol |
| IUPAC name | 2-chloro-4-(3,5-dimethylphenyl)benzoic acid |
| InChIKey | WNPIQYRMRNJDCX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C2=CC(=C(C=C2)C(=O)O)Cl)C |
Computed by PubChem (NCBI)