cas: 1107620-72-3 — see every product listed under this CAS number, including other names
4-(Boc-aminomethyl)pyrazole, 98%, 98% (CAS 1107620-72-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114K7E-100mg |
| cas | 1107620-72-3 |
| size | 100mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 280.40 Pln | |
| Chemat | 1g | 530.00 Pln | |
| Chemat | 5g | 2027.60 Pln | |
| Chemat | 10g | 3645.20 Pln | |
| Chemat | 25g | 6333.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(1H-pyrazol-4-ylmethyl)carbamate (CAS 1107620-72-3) is a chemical compound with the molecular formula C9H15N3O2 and a molecular weight of 197.23 g/mol. IUPAC name: tert-butyl N-(1H-pyrazol-4-ylmethyl)carbamate. InChIKey: QHQQGFZVUMTRDH-UHFFFAOYSA-N.
| Molecular formula | C9H15N3O2 |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | tert-butyl N-(1H-pyrazol-4-ylmethyl)carbamate |
| InChIKey | QHQQGFZVUMTRDH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CNN=C1 |
Computed by PubChem (NCBI)