cas: 1107620-72-3 — see every product listed under this CAS number, including other names
4-(Boc-aminomethyl)pyrazole 98% (CAS 1107620-72-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A830550-100mg |
| cas | 1107620-72-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 476.06 Pln | |
| Ambeed | 250mg | 648.50 Pln | |
| Ambeed | 1g | 837.62 Pln | |
| Ambeed | 5g | 2089.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A830550 |
Tert-butyl N-(1H-pyrazol-4-ylmethyl)carbamate (CAS 1107620-72-3) is a chemical compound with the molecular formula C9H15N3O2 and a molecular weight of 197.23 g/mol. IUPAC name: tert-butyl N-(1H-pyrazol-4-ylmethyl)carbamate. InChIKey: QHQQGFZVUMTRDH-UHFFFAOYSA-N.
| Molecular formula | C9H15N3O2 |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | tert-butyl N-(1H-pyrazol-4-ylmethyl)carbamate |
| InChIKey | QHQQGFZVUMTRDH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CNN=C1 |
Computed by PubChem (NCBI)