cas: 1645275-47-3 — see every product listed under this CAS number, including other names
4-(Bromomethyl)-2-fluorobenzenesulphonamide 98% (CAS 1645275-47-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A967815-250mg |
| cas | 1645275-47-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 387.06 Pln | |
| Ambeed | 5g | 1021.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A967815 |
4-(bromomethyl)-2-fluorobenzenesulfonamide (CAS 1645275-47-3) is a chemical compound with the molecular formula C7H7BrFNO2S and a molecular weight of 268.11 g/mol. IUPAC name: 4-(bromomethyl)-2-fluorobenzenesulfonamide. InChIKey: MEDZIOXQDCBAHD-UHFFFAOYSA-N.
| Molecular formula | C7H7BrFNO2S |
|---|---|
| Molecular weight | 268.11 g/mol |
| IUPAC name | 4-(bromomethyl)-2-fluorobenzenesulfonamide |
| InChIKey | MEDZIOXQDCBAHD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CBr)F)S(=O)(=O)N |
Computed by PubChem (NCBI)